ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2164-33-2 2-Chloromethyl-1,4-benzodioxane |
|
Produkt-Name | 2-Chloromethyl-1,4-benzodioxane |
Englischer Name | 2-Chloromethyl-1,4-benzodioxane;2-(Chloromethyl)-2,3-dihydro-1,4-benzodioxine;2-(chloromethyl)-2,3-dihydrobenzo[b][1,4]dioxine; |
Molekulare Formel | C9H9ClO2 |
Molecular Weight | 184.6196 |
InChl | InChI=1/C9H9ClO2/c10-5-7-6-11-8-3-1-2-4-9(8)12-7/h1-4,7H,5-6H2 |
CAS Registry Number | 2164-33-2 |
EINECS | 218-502-5 |
Molecular Structure | ![]() |
Dichte | 1.224g/cm3 |
Siedepunkt | 270.1°C at 760 mmHg |
Brechungsindex | 1.529 |
Flammpunkt | 114.3°C |
Dampfdruck | 0.0116mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R34##Causes burns.:; |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |