ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
21962-84-5 1,4-Dioxoxan-5,8-dion |
|
| Produkt-Name | 1,4-Dioxoxan-5,8-dion |
| Synonyme | 1,4-Dioxocan-5,8-dion |
| Englischer Name | 1,4-dioxocane-5,8-dione;1,4-Dioxocane-5,8-dione |
| Molekulare Formel | C6H8O4 |
| Molecular Weight | 144.1253 |
| InChl | InChI=1/C6H8O4/c7-5-1-2-6(8)10-4-3-9-5/h1-4H2 |
| CAS Registry Number | 21962-84-5 |
| EINECS | 244-684-0 |
| Molecular Structure | ![]() |
| Dichte | 1.231g/cm3 |
| Siedepunkt | 409.8°C at 760 mmHg |
| Brechungsindex | 1.444 |
| Flammpunkt | 228.3°C |
| Dampfdruck | 6.31E-07mmHg at 25°C |
| MSDS | |