ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
219828-75-8 N'-Butyl-N'-phenylacetohydrazid |
|
| Produkt-Name | N'-Butyl-N'-phenylacetohydrazid |
| Englischer Name | N'-butyl-N'-phenylacetohydrazide; |
| Molekulare Formel | C12H18N2O |
| Molecular Weight | 206.2841 |
| InChl | InChI=1/C12H18N2O/c1-3-4-10-14(13-11(2)15)12-8-6-5-7-9-12/h5-9H,3-4,10H2,1-2H3,(H,13,15) |
| CAS Registry Number | 219828-75-8 |
| Molecular Structure | ![]() |
| Dichte | 1.035g/cm3 |
| Brechungsindex | 1.542 |
| MSDS | |