ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22246-04-4 7-methoxy-3,4-dihydroisoquinolin-1(2H)-one |
|
| Produkt-Name | 7-methoxy-3,4-dihydroisoquinolin-1(2H)-one |
| Englischer Name | 7-methoxy-3,4-dihydroisoquinolin-1(2H)-one;7-methoxy-1,2,3,4-tetrahydroisoquinolin-1-one |
| Molekulare Formel | C10H11NO2 |
| Molecular Weight | 177.1998 |
| InChl | InChI=1/C10H11NO2/c1-13-8-3-2-7-4-5-11-10(12)9(7)6-8/h2-3,6H,4-5H2,1H3,(H,11,12) |
| CAS Registry Number | 22246-04-4 |
| Molecular Structure | ![]() |
| Dichte | 1.16g/cm3 |
| Siedepunkt | 435.789°C at 760 mmHg |
| Brechungsindex | 1.549 |
| Flammpunkt | 217.358°C |
| Dampfdruck | 0mmHg at 25°C |
| MSDS | |