ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22395-24-0 3',4',7-Trimethoxyflavone | 
    |
| Produkt-Name | 3',4',7-Trimethoxyflavone | 
| Englischer Name | 3',4',7-Trimethoxyflavone;7,3',4'-Trimethoxyflavone;2-(3,4-Dimethoxyphenyl)-7-methoxy-4H-1-benzopyran-4-one;4H-1-Benzopyran-4-one, 2-(3,4-dimethoxyphenyl)-7-methoxy-;2-(3,4-dimethoxyphenyl)-7-methoxy-4H-chromen-4-one | 
| Molekulare Formel | C18H16O5 | 
| Molecular Weight | 312.3166 | 
| InChl | InChI=1/C18H16O5/c1-20-12-5-6-13-14(19)10-16(23-17(13)9-12)11-4-7-15(21-2)18(8-11)22-3/h4-10H,1-3H3 | 
| CAS Registry Number | 22395-24-0 | 
| Molecular Structure | ![]()  | 
    
| Dichte | 1.242g/cm3 | 
| Siedepunkt | 477.4°C at 760 mmHg | 
| Brechungsindex | 1.585 | 
| Flammpunkt | 212°C | 
| Dampfdruck | 2.81E-09mmHg at 25°C | 
| Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; | 
    
| MSDS | |