ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22395-24-0 3',4',7-Trimethoxyflavone |
|
Produkt-Name | 3',4',7-Trimethoxyflavone |
Englischer Name | 3',4',7-Trimethoxyflavone;7,3',4'-Trimethoxyflavone;2-(3,4-Dimethoxyphenyl)-7-methoxy-4H-1-benzopyran-4-one;4H-1-Benzopyran-4-one, 2-(3,4-dimethoxyphenyl)-7-methoxy-;2-(3,4-dimethoxyphenyl)-7-methoxy-4H-chromen-4-one |
Molekulare Formel | C18H16O5 |
Molecular Weight | 312.3166 |
InChl | InChI=1/C18H16O5/c1-20-12-5-6-13-14(19)10-16(23-17(13)9-12)11-4-7-15(21-2)18(8-11)22-3/h4-10H,1-3H3 |
CAS Registry Number | 22395-24-0 |
Molecular Structure | ![]() |
Dichte | 1.242g/cm3 |
Siedepunkt | 477.4°C at 760 mmHg |
Brechungsindex | 1.585 |
Flammpunkt | 212°C |
Dampfdruck | 2.81E-09mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |