ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22726-30-3 7-Methoxy-1,4-benzothiazin-3(4H)-one |
|
| Produkt-Name | 7-Methoxy-1,4-benzothiazin-3(4H)-one |
| Englischer Name | 7-Methoxy-1,4-benzothiazin-3(4H)-one;2H-1,4-benzothiazin-3(4H)-one, 7-methoxy-;7-Methoxy-2H-1,4-benzothiazin-3(4H)-one |
| Molekulare Formel | C9H9NO2S |
| Molecular Weight | 195.2383 |
| InChl | InChI=1/C9H9NO2S/c1-12-6-2-3-7-8(4-6)13-5-9(11)10-7/h2-4H,5H2,1H3,(H,10,11) |
| CAS Registry Number | 22726-30-3 |
| Molecular Structure | ![]() |
| Dichte | 1.282g/cm3 |
| Siedepunkt | 395.7°C at 760 mmHg |
| Brechungsindex | 1.6 |
| Flammpunkt | 193.1°C |
| Dampfdruck | 1.81E-06mmHg at 25°C |
| MSDS | |