ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2299-73-2 4-Methoxybenzaldehyde azine |
|
| Produkt-Name | 4-Methoxybenzaldehyde azine |
| Englischer Name | 4-Methoxybenzaldehyde azine;p-Anisaldehyde azine;4-Methoxybenzalazine;bis(4-methoxybenzylidene)hydrazine;(1E,2E)-bis[(4-methoxyphenyl)methylidene]hydrazine |
| Molekulare Formel | C16H16N2O2 |
| Molecular Weight | 268.31 |
| InChl | InChI=1/C16H16N2O2/c1-19-15-7-3-13(4-8-15)11-17-18-12-14-5-9-16(20-2)10-6-14/h3-12H,1-2H3/b17-11+,18-12u |
| CAS Registry Number | 2299-73-2 |
| Molecular Structure | ![]() |
| Brechungsindex | 1.54 |
| Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |