ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
23853-41-0 S-{3-[2-(2,4-dinitrophenyl)hydrazinylidene]-2-phenylpropyl} benzenecarbothioate |
|
| Produkt-Name | S-{3-[2-(2,4-dinitrophenyl)hydrazinylidene]-2-phenylpropyl} benzenecarbothioate |
| Englischer Name | S-{3-[2-(2,4-dinitrophenyl)hydrazinylidene]-2-phenylpropyl} benzenecarbothioate; |
| Molekulare Formel | C22H18N4O5S |
| Molecular Weight | 450.4671 |
| InChl | InChI=1/C22H18N4O5S/c27-22(17-9-5-2-6-10-17)32-15-18(16-7-3-1-4-8-16)14-23-24-20-12-11-19(25(28)29)13-21(20)26(30)31/h1-14,18,24H,15H2 |
| CAS Registry Number | 23853-41-0 |
| Molecular Structure | ![]() |
| Dichte | 1.35g/cm3 |
| Siedepunkt | 628°C at 760 mmHg |
| Brechungsindex | 1.656 |
| Flammpunkt | 333.6°C |
| Dampfdruck | 1.1E-15mmHg at 25°C |
| MSDS | |