ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
24088-65-1 [2-[(4-methylpiperazin-1-yl)methyl]phenyl]-phenyl-methanon |
|
| Produkt-Name | [2-[(4-methylpiperazin-1-yl)methyl]phenyl]-phenyl-methanon |
| Englischer Name | [2-[(4-methylpiperazin-1-yl)methyl]phenyl]-phenyl-methanone; |
| Molekulare Formel | C19H22N2O |
| Molecular Weight | 294.3908 |
| InChl | InChI=1/C19H22N2O/c1-20-11-13-21(14-12-20)15-17-9-5-6-10-18(17)19(22)16-7-3-2-4-8-16/h2-10H,11-15H2,1H3 |
| CAS Registry Number | 24088-65-1 |
| Molecular Structure | ![]() |
| Dichte | 1.11g/cm3 |
| Siedepunkt | 450.2°C at 760 mmHg |
| Brechungsindex | 1.588 |
| Flammpunkt | 192.2°C |
| Dampfdruck | 2.7E-08mmHg at 25°C |
| MSDS | |