ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
244-63-3 Norharman |
|
| Produkt-Name | Norharman |
| Englischer Name | Norharman;9H-Pyrido[3,4-B]Indole |
| Molekulare Formel | C11H8N2 |
| Molecular Weight | 168.1946 |
| InChl | InChI=1/C11H8N2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10/h1-7,13H |
| CAS Registry Number | 244-63-3 |
| EINECS | 205-959-0 |
| Molecular Structure | ![]() |
| Dichte | 1.301g/cm3 |
| Schmelzpunkt | 198-202℃ |
| Siedepunkt | 391.3°C at 760 mmHg |
| Brechungsindex | 1.784 |
| Flammpunkt | 182.1°C |
| Dampfdruck | 5.62E-06mmHg at 25°C |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |