ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25357-02-2 (2E)-3-(3-chloro-4-ethoxyphenyl)-N-hydroxyprop-2-enamide |
|
| Produkt-Name | (2E)-3-(3-chloro-4-ethoxyphenyl)-N-hydroxyprop-2-enamide |
| Englischer Name | (2E)-3-(3-chloro-4-ethoxyphenyl)-N-hydroxyprop-2-enamide; |
| Molekulare Formel | C11H12ClNO3 |
| Molecular Weight | 241.6709 |
| InChl | InChI=1/C11H12ClNO3/c1-2-16-10-5-3-8(7-9(10)12)4-6-11(14)13-15/h3-7,15H,2H2,1H3,(H,13,14)/b6-4+ |
| CAS Registry Number | 25357-02-2 |
| Molecular Structure | ![]() |
| Dichte | 1.297g/cm3 |
| Brechungsindex | 1.597 |
| MSDS | |