ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25787-08-0 3,5-bis({[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]carbamoyl}amino)-N,N-diethylbenzamide |
|
| Produkt-Name | 3,5-bis({[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]carbamoyl}amino)-N,N-diethylbenzamide |
| Englischer Name | 3,5-bis({[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]carbamoyl}amino)-N,N-diethylbenzamide; |
| Molekulare Formel | C31H35N9O3 |
| Molecular Weight | 581.6681 |
| InChl | InChI=1/C31H35N9O3/c1-3-40(4-2)29(41)22-17-25(38-30(42)36-23-9-5-20(6-10-23)27-32-13-14-33-27)19-26(18-22)39-31(43)37-24-11-7-21(8-12-24)28-34-15-16-35-28/h5-12,17-19H,3-4,13-16H2,1-2H3,(H,32,33)(H,34,35)(H2,36,38,42)(H2,37,39,43) |
| CAS Registry Number | 25787-08-0 |
| Molecular Structure | ![]() |
| Dichte | 1.36g/cm3 |
| Brechungsindex | 1.691 |
| MSDS | |