ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
26616-34-2 Octahydro-2,5-methano-2H-indeno[1,2-b]oxirenol |
|
| Produkt-Name | Octahydro-2,5-methano-2H-indeno[1,2-b]oxirenol |
| Synonyme | 2,5-Methano-2H-indeno(1,2-b)oxirenol, octahydro-; Octahydro-2,5-methano-2H-indeno(1,2-b)oxirenol; Octahydro-1aH-2,5-methanoindeno[1,2-b]oxiren-1a-ol; |
| Englischer Name | octahydro-2,5-methano-2H-indeno[1,2-b]oxirenol;2,5-Methano-2H-indeno(1,2-b)oxirenol, octahydro-;Octahydro-2,5-methano-2H-indeno(1,2-b)oxirenol;octahydro-1aH-2,5-methanoindeno[1,2-b]oxiren-1a-ol |
| Molekulare Formel | C10H14O2 |
| Molecular Weight | 166.217 |
| InChl | InChI=1/C10H14O2/c11-10-8(12-10)4-7-5-1-2-6(3-5)9(7)10/h5-9,11H,1-4H2 |
| CAS Registry Number | 26616-34-2 |
| EINECS | 247-849-5 |
| Molecular Structure | ![]() |
| Dichte | 1.373g/cm3 |
| Siedepunkt | 284.4°C at 760 mmHg |
| Brechungsindex | 1.635 |
| Flammpunkt | 131.8°C |
| Dampfdruck | 0.000344mmHg at 25°C |
| MSDS | |