ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2719-08-6 Methyl 2-acetamidobenzoate |
|
Produkt-Name | Methyl 2-acetamidobenzoate |
Englischer Name | Methyl 2-acetamidobenzoate;methyl 2-(acetylamino)benzoate;Methyl N-acetylanthranilate;ACETYL-N-METHYL-ANTHRANILATE |
Molekulare Formel | C10H11NO3 |
Molecular Weight | 193.1992 |
InChl | InChI=1/C10H11NO3/c1-7(12)11-9-6-4-3-5-8(9)10(13)14-2/h3-6H,1-2H3,(H,11,12) |
CAS Registry Number | 2719-08-6 |
EINECS | 220-318-5 |
Molecular Structure | ![]() |
Dichte | 1.204g/cm3 |
Schmelzpunkt | 97-101℃ |
Siedepunkt | 376.3°C at 760 mmHg |
Brechungsindex | 1.565 |
Flammpunkt | 181.4°C |
Dampfdruck | 7.3E-06mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |