ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2769-71-3 2,6-dimethylphenyl isocyanide |
|
| Produkt-Name | 2,6-dimethylphenyl isocyanide |
| Englischer Name | 2,6-dimethylphenyl isocyanide;2,6-Dimethylphenylisonitrile;2,6-Dimethylphenyl isocyanide;2,6-Xyleneisonitrile;NSC 141690;2,6-Xylyl isocyanide;Benzene, 2-isocyano-1,3-dimethyl- (9CI);2-isocyanato-1,3-dimethylbenzene;2,6-dimethyl-N-methylidyneanilinium |
| Molekulare Formel | C9H10N |
| Molecular Weight | 132.1819 |
| InChl | InChI=1/C9H10N/c1-7-5-4-6-8(2)9(7)10-3/h3-6H,1-2H3/q+1 |
| CAS Registry Number | 2769-71-3 |
| EINECS | 220-459-2 |
| Molecular Structure | ![]() |
| Schmelzpunkt | 72-75℃ |
| MSDS | |