ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
28040-72-4 Butyl-Prop-2-enoat |
|
Produkt-Name | Butyl-Prop-2-enoat |
Synonyme | 2-ethylhexyl prop-2-enoat; Vinylacetat;; |
Englischer Name | butyl prop-2-enoate; 2-ethylhexyl prop-2-enoate; vinyl acetate;2-Propenoic acid, butyl ester, polymer with ethenyl acetate and 2-ethylhexyl 2-propenoate |
Molekulare Formel | C22H38O6 |
Molecular Weight | 398.5335 |
InChl | InChI=1/C11H20O2.C7H12O2.C4H6O2/c1-4-7-8-10(5-2)9-13-11(12)6-3;1-3-5-6-9-7(8)4-2;1-3-6-4(2)5/h6,10H,3-5,7-9H2,1-2H3;4H,2-3,5-6H2,1H3;3H,1H2,2H3 |
CAS Registry Number | 28040-72-4 |
Molecular Structure | ![]() |
Siedepunkt | 216°C at 760 mmHg |
Flammpunkt | 79.4°C |
Dampfdruck | 0.143mmHg at 25°C |
MSDS |