ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
29043-07-0 3',4',5,5',6,7-Hexamethoxyflavone |
|
Produkt-Name | 3',4',5,5',6,7-Hexamethoxyflavone |
Englischer Name | 3',4',5,5',6,7-Hexamethoxyflavone;5,6,7,3',4',5'-Hexamethoxyflavone;5,6,7-trimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one |
Molekulare Formel | C21H22O8 |
Molecular Weight | 402.3946 |
InChl | InChI=1/C21H22O8/c1-23-15-7-11(8-16(24-2)19(15)26-4)13-9-12(22)18-14(29-13)10-17(25-3)20(27-5)21(18)28-6/h7-10H,1-6H3 |
CAS Registry Number | 29043-07-0 |
Molecular Structure | ![]() |
Dichte | 1.244g/cm3 |
Siedepunkt | 572.8°C at 760 mmHg |
Brechungsindex | 1.558 |
Flammpunkt | 249.9°C |
Dampfdruck | 3.95E-13mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |