ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
29425-97-6 Decansäure, Verbindung mit Dibutylamin (1:1) |
|
| Produkt-Name | Decansäure, Verbindung mit Dibutylamin (1:1) |
| Synonyme | Decansäure, kompatibel mit N-Butyl-1-butanamin (1:1); Dibutylamin, Decansäuresalz; Decansäure, Verbindung mit Dibutylamin (1:1); Decansäure - N-Butylbutan-1-amin (1:1); |
| Englischer Name | decanoic acid, compound with dibutylamine (1:1);Decanoic acid, compd. with N-butyl-1-butanamine (1:1);Dibutylamine, decanoic acid salt;Decanoic acid, compound with dibutylamine (1:1);decanoic acid - N-butylbutan-1-amine (1:1) |
| Molekulare Formel | C18H39NO2 |
| Molecular Weight | 301.5078 |
| InChl | InChI=1/C10H20O2.C8H19N/c1-2-3-4-5-6-7-8-9-10(11)12;1-3-5-7-9-8-6-4-2/h2-9H2,1H3,(H,11,12);9H,3-8H2,1-2H3 |
| CAS Registry Number | 29425-97-6 |
| EINECS | 249-620-5 |
| Molecular Structure | ![]() |
| Siedepunkt | 269.6°C at 760 mmHg |
| Flammpunkt | 121.8°C |
| Dampfdruck | 0.00355mmHg at 25°C |
| MSDS | |