ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
29473-97-0 ethyl [2-(naphthalen-1-yl)-4-(piperidin-1-yl)butyl]carbamate |
|
| Produkt-Name | ethyl [2-(naphthalen-1-yl)-4-(piperidin-1-yl)butyl]carbamate |
| Englischer Name | ethyl [2-(naphthalen-1-yl)-4-(piperidin-1-yl)butyl]carbamate; |
| Molekulare Formel | C22H30N2O2 |
| Molecular Weight | 354.4858 |
| InChl | InChI=1/C22H30N2O2/c1-2-26-22(25)23-17-19(13-16-24-14-6-3-7-15-24)21-12-8-10-18-9-4-5-11-20(18)21/h4-5,8-12,19H,2-3,6-7,13-17H2,1H3,(H,23,25) |
| CAS Registry Number | 29473-97-0 |
| Molecular Structure | ![]() |
| Dichte | 1.089g/cm3 |
| Siedepunkt | 526°C at 760 mmHg |
| Brechungsindex | 1.57 |
| Flammpunkt | 271.9°C |
| Dampfdruck | 3.71E-11mmHg at 25°C |
| MSDS | |