ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2997-87-7 2-(N-ethylanilino)ethyl-2-methylprop-2-enoat |
|
| Produkt-Name | 2-(N-ethylanilino)ethyl-2-methylprop-2-enoat |
| Synonyme | 2-[Ethyl(phenyl)amino]ethylmethacrylat; 2-Propensäure, 2-Methyl-, 2-(ethylphenylamino)ethylester |
| Englischer Name | 2-(N-ethylanilino)ethyl 2-methylprop-2-enoate;2-[Ethyl(phenyl)amino]ethyl methacrylate;2-propenoic acid, 2-methyl-, 2-(ethylphenylamino)ethyl ester |
| Molekulare Formel | C14H19NO2 |
| Molecular Weight | 233.3062 |
| InChl | InChI=1/C14H19NO2/c1-4-15(13-8-6-5-7-9-13)10-11-17-14(16)12(2)3/h5-9H,2,4,10-11H2,1,3H3 |
| CAS Registry Number | 2997-87-7 |
| Molecular Structure | ![]() |
| Dichte | 1.038g/cm3 |
| Siedepunkt | 341.211°C at 760 mmHg |
| Brechungsindex | 1.532 |
| Flammpunkt | 121.46°C |
| Dampfdruck | 0mmHg at 25°C |
| MSDS | |