ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
305-53-3 Iodoacetic acid, sodium salt |
|
| Produkt-Name | Iodoacetic acid, sodium salt |
| Englischer Name | Iodoacetic acid, sodium salt;Sodium iodoacetate;Iodoacetic acid sodium salt |
| Molekulare Formel | C2H2INaO2 |
| Molecular Weight | 207.9303 |
| InChl | InChI=1/C2H3IO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
| CAS Registry Number | 305-53-3 |
| EINECS | 206-165-7 |
| Molecular Structure | ![]() |
| Schmelzpunkt | 208-210℃ |
| Siedepunkt | 262.1°C at 760 mmHg |
| Flammpunkt | 112.3°C |
| Dampfdruck | 0.00329mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R25##Toxic if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Beschreibung | S22##Do not inhale dust.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |