ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
31118-87-3 1-(2,4,6-Trichlorophenyl)-2-thiourea |
|
| Produkt-Name | 1-(2,4,6-Trichlorophenyl)-2-thiourea |
| Englischer Name | 1-(2,4,6-Trichlorophenyl)-2-thiourea;1-(2,4,6-trichlorophenyl)thiourea |
| Molekulare Formel | C7H5Cl3N2S |
| Molecular Weight | 255.552 |
| InChl | InChI=1/C7H5Cl3N2S/c8-3-1-4(9)6(5(10)2-3)12-7(11)13/h1-2H,(H3,11,12,13) |
| CAS Registry Number | 31118-87-3 |
| Molecular Structure | ![]() |
| Dichte | 1.665g/cm3 |
| Siedepunkt | 342.7°C at 760 mmHg |
| Brechungsindex | 1.732 |
| Flammpunkt | 161.1°C |
| Dampfdruck | 7.37E-05mmHg at 25°C |
| MSDS | |