ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
31167-35-8 N-(5-formylthiophen-2-yl)acetamide |
|
| Produkt-Name | N-(5-formylthiophen-2-yl)acetamide |
| Englischer Name | N-(5-formylthiophen-2-yl)acetamide;acetamide, N-(5-formyl-2-thienyl)-;N-(5-Formyl-2-thienyl)acetamide |
| Molekulare Formel | C7H7NO2S |
| Molecular Weight | 169.201 |
| InChl | InChI=1/C7H7NO2S/c1-5(10)8-7-3-2-6(4-9)11-7/h2-4H,1H3,(H,8,10) |
| CAS Registry Number | 31167-35-8 |
| Molecular Structure | ![]() |
| Dichte | 1.368g/cm3 |
| Siedepunkt | 405.4°C at 760 mmHg |
| Brechungsindex | 1.66 |
| Flammpunkt | 199°C |
| Dampfdruck | 8.78E-07mmHg at 25°C |
| MSDS | |