ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3224-68-8 N-(2-hydroxy-5-nitrophenyl)-3-phenylprop-2-enamid |
|
| Produkt-Name | N-(2-hydroxy-5-nitrophenyl)-3-phenylprop-2-enamid |
| Englischer Name | N-(2-hydroxy-5-nitrophenyl)-3-phenylprop-2-enamide; |
| Molekulare Formel | C15H12N2O4 |
| Molecular Weight | 284.2668 |
| InChl | InChI=1/C15H12N2O4/c18-14-8-7-12(17(20)21)10-13(14)16-15(19)9-6-11-4-2-1-3-5-11/h1-10,18H,(H,16,19) |
| CAS Registry Number | 3224-68-8 |
| Molecular Structure | ![]() |
| Dichte | 1.409g/cm3 |
| Siedepunkt | 537.2°C at 760 mmHg |
| Brechungsindex | 1.721 |
| Flammpunkt | 278.7°C |
| Dampfdruck | 3.73E-12mmHg at 25°C |
| MSDS | |