ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
32974-80-4 2,2-Dichlor-1H-inden-1,3(2H)-dion |
|
| Produkt-Name | 2,2-Dichlor-1H-inden-1,3(2H)-dion |
| Englischer Name | 2,2-dichloro-1H-indene-1,3(2H)-dione; |
| Molekulare Formel | C9H4Cl2O2 |
| Molecular Weight | 215.0329 |
| InChl | InChI=1/C9H4Cl2O2/c10-9(11)7(12)5-3-1-2-4-6(5)8(9)13/h1-4H |
| CAS Registry Number | 32974-80-4 |
| Molecular Structure | ![]() |
| Dichte | 1.55g/cm3 |
| Siedepunkt | 328.2°C at 760 mmHg |
| Brechungsindex | 1.62 |
| Flammpunkt | 138.2°C |
| Dampfdruck | 0.000193mmHg at 25°C |
| MSDS | |