ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
331-62-4 3-fluoro-4-methoxybenzonitrile |
|
| Produkt-Name | 3-fluoro-4-methoxybenzonitrile |
| Englischer Name | 3-fluoro-4-methoxybenzonitrile;Fluoromethoxybenzonitrile |
| Molekulare Formel | C8H6FNO |
| Molecular Weight | 151.1377 |
| InChl | InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
| CAS Registry Number | 331-62-4 |
| Molecular Structure | ![]() |
| Dichte | 1.18g/cm3 |
| Siedepunkt | 254.3°C at 760 mmHg |
| Brechungsindex | 1.505 |
| Flammpunkt | 107.6°C |
| Dampfdruck | 0.0173mmHg at 25°C |
| Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Safety Beschreibung | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |