ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332-48-9 4-Fluorophenoxy-ethylbromide |
|
| Produkt-Name | 4-Fluorophenoxy-ethylbromide |
| Englischer Name | 4-Fluorophenoxy-ethylbromide;1-(2-Bromoethoxy)-4-fluorobenzene;1-(1-bromoethoxy)-4-fluorobenzene |
| Molekulare Formel | C8H8BrFO |
| Molecular Weight | 219.0509 |
| InChl | InChI=1/C8H8BrFO/c1-6(9)11-8-4-2-7(10)3-5-8/h2-6H,1H3 |
| CAS Registry Number | 332-48-9 |
| Molecular Structure | ![]() |
| Dichte | 1.483g/cm3 |
| Siedepunkt | 242.309°C at 760 mmHg |
| Brechungsindex | 1.525 |
| Flammpunkt | 119.849°C |
| Dampfdruck | 0.053mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |