ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3377-86-4 2-bromohexane |
|
Produkt-Name | 2-bromohexane |
Englischer Name | 2-bromohexane;Hexane, 2-bromo- |
Molekulare Formel | C6H13Br |
Molecular Weight | 165.0714 |
InChl | InChI=1/C6H13Br/c1-3-4-5-6(2)7/h6H,3-5H2,1-2H3/t6-/m0/s1 |
CAS Registry Number | 3377-86-4 |
EINECS | 222-173-3 |
Molecular Structure | ![]() |
Dichte | 1.169g/cm3 |
Siedepunkt | 144°C at 760 mmHg |
Brechungsindex | 1.444 |
Flammpunkt | 40.1°C |
Dampfdruck | 6.54mmHg at 25°C |
Risk Codes | R10##Flammable.:; |
Safety Beschreibung | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |