ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
352018-91-8 1-(4-Cyanophenyl)-4-piperidincarbohydrazid |
|
Produkt-Name | 1-(4-Cyanophenyl)-4-piperidincarbohydrazid |
Synonyme | 1-(4-Cyanophenyl)piperidin-4-carbohydrazid; |
Englischer Name | 1-(4-cyanophenyl)-4-piperidinecarbohydrazide;1-(4-cyanophenyl)piperidine-4-carbohydrazide |
Molekulare Formel | C13H16N4O |
Molecular Weight | 244.2923 |
InChl | InChI=1/C13H16N4O/c14-9-10-1-3-12(4-2-10)17-7-5-11(6-8-17)13(18)16-15/h1-4,11H,5-8,15H2,(H,16,18) |
CAS Registry Number | 352018-91-8 |
Molecular Structure | ![]() |
Dichte | 1.251g/cm3 |
Siedepunkt | 528.975°C at 760 mmHg |
Brechungsindex | 1.617 |
Flammpunkt | 273.715°C |
Dampfdruck | 0mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Safety Beschreibung | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |