ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
355815-47-3 (4-Fluorphenyl)-N-(4-methoxybenzyl)methanaminium |
|
| Produkt-Name | (4-Fluorphenyl)-N-(4-methoxybenzyl)methanaminium |
| Englischer Name | (4-fluorophenyl)-N-(4-methoxybenzyl)methanaminium; |
| Molekulare Formel | C15H17FNO |
| Molecular Weight | 246.2994 |
| InChl | InChI=1/C15H16FNO/c1-18-15-8-4-13(5-9-15)11-17-10-12-2-6-14(16)7-3-12/h2-9,17H,10-11H2,1H3/p+1 |
| CAS Registry Number | 355815-47-3 |
| Siedepunkt | 350.2°C at 760 mmHg |
| Flammpunkt | 165.6°C |
| Dampfdruck | 4.45E-05mmHg at 25°C |
| MSDS | |