ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
35657-37-5 (aminooxy)(4-nitrophenyl)methanone |
|
| Produkt-Name | (aminooxy)(4-nitrophenyl)methanone |
| Englischer Name | (aminooxy)(4-nitrophenyl)methanone; |
| Molekulare Formel | C7H6N2O4 |
| Molecular Weight | 182.1335 |
| InChl | InChI=1/C7H6N2O4/c8-13-7(10)5-1-3-6(4-2-5)9(11)12/h1-4H,8H2 |
| CAS Registry Number | 35657-37-5 |
| Molecular Structure | ![]() |
| Dichte | 1.441g/cm3 |
| Siedepunkt | 361.4°C at 760 mmHg |
| Brechungsindex | 1.604 |
| Flammpunkt | 172.4°C |
| Dampfdruck | 2.07E-05mmHg at 25°C |
| MSDS | |