ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
37013-41-5 2-[(dimethylamino)methyl]-4-[(1E)-1-ethyl-2-(4-hydroxyphenyl)but-1-en-1-yl]phenol |
|
| Produkt-Name | 2-[(dimethylamino)methyl]-4-[(1E)-1-ethyl-2-(4-hydroxyphenyl)but-1-en-1-yl]phenol |
| Englischer Name | 2-[(dimethylamino)methyl]-4-[(1E)-1-ethyl-2-(4-hydroxyphenyl)but-1-en-1-yl]phenol; |
| Molekulare Formel | C21H27NO2 |
| Molecular Weight | 325.4446 |
| InChl | InChI=1/C21H27NO2/c1-5-19(15-7-10-18(23)11-8-15)20(6-2)16-9-12-21(24)17(13-16)14-22(3)4/h7-13,23-24H,5-6,14H2,1-4H3/b20-19+ |
| CAS Registry Number | 37013-41-5 |
| Molecular Structure | ![]() |
| Dichte | 1.089g/cm3 |
| Siedepunkt | 440.7°C at 760 mmHg |
| Brechungsindex | 1.592 |
| Flammpunkt | 197.2°C |
| Dampfdruck | 2.23E-08mmHg at 25°C |
| MSDS | |