ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
371-14-2 4-fluorophenylhydrazine |
|
| Produkt-Name | 4-fluorophenylhydrazine |
| Englischer Name | 4-fluorophenylhydrazine;1-(4-Fluorophenyl)hydrazine;AKOS BBS-00006439;(4-fluorophenyl)hydrazine |
| Molekulare Formel | C6H7FN2 |
| Molecular Weight | 126.1316 |
| InChl | InChI=1/C6H7FN2/c7-5-1-3-6(9-8)4-2-5/h1-4,9H,8H2 |
| CAS Registry Number | 371-14-2 |
| EINECS | 206-732-9 |
| Molecular Structure | ![]() |
| Dichte | 1.257g/cm3 |
| Siedepunkt | 226.7°C at 760 mmHg |
| Brechungsindex | 1.609 |
| Flammpunkt | 90.9°C |
| Dampfdruck | 0.0805mmHg at 25°C |
| MSDS | |