ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
37630-47-0 1,5-Bis(4-chlorphenyl)penta-1,4-dien-3-on |
|
| Produkt-Name | 1,5-Bis(4-chlorphenyl)penta-1,4-dien-3-on |
| Englischer Name | 1,5-bis(4-chlorophenyl)penta-1,4-dien-3-one; |
| Molekulare Formel | C17H12Cl2O |
| Molecular Weight | 303.1826 |
| InChl | InChI=1/C17H12Cl2O/c18-15-7-1-13(2-8-15)5-11-17(20)12-6-14-3-9-16(19)10-4-14/h1-12H |
| CAS Registry Number | 37630-47-0 |
| Molecular Structure | ![]() |
| Dichte | 1.28g/cm3 |
| Siedepunkt | 464.9°C at 760 mmHg |
| Brechungsindex | 1.66 |
| Flammpunkt | 195.5°C |
| Dampfdruck | 8.04E-09mmHg at 25°C |
| MSDS | |