ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39828-35-8 2,4- dimethoxybenzoyl chloride |
|
Produkt-Name | 2,4- dimethoxybenzoyl chloride |
Englischer Name | 2,4- dimethoxybenzoyl chloride;2,4-DIMETHOXYBENZOYL CHLORIDE;benzoyl chloride, 2,4-dimethoxy- |
Molekulare Formel | C9H9ClO3 |
Molecular Weight | 200.619 |
InChl | InChI=1/C9H9ClO3/c1-12-6-3-4-7(9(10)11)8(5-6)13-2/h3-5H,1-2H3 |
CAS Registry Number | 39828-35-8 |
Molecular Structure | ![]() |
Dichte | 1.224g/cm3 |
Schmelzpunkt | 58℃ |
Siedepunkt | 306.7°C at 760 mmHg |
Brechungsindex | 1.52 |
Flammpunkt | 134.1°C |
Dampfdruck | 0.000757mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R34##Causes burns.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |