ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
43111-31-5 2-Chlorophenoxyacetonitrile |
|
| Produkt-Name | 2-Chlorophenoxyacetonitrile |
| Englischer Name | 2-Chlorophenoxyacetonitrile; |
| Molekulare Formel | C8H6ClNO |
| Molecular Weight | 167.5923 |
| InChl | InChI=1/C8H6ClNO/c9-7-3-1-2-4-8(7)11-6-5-10/h1-4H,6H2 |
| CAS Registry Number | 43111-31-5 |
| Molecular Structure | ![]() |
| Dichte | 1.238g/cm3 |
| Siedepunkt | 276.7°C at 760 mmHg |
| Brechungsindex | 1.538 |
| Flammpunkt | 121.2°C |
| Dampfdruck | 0.00472mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Safety Beschreibung | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |