ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4463-33-6 2,3-Dimethoxytoluene |
|
| Produkt-Name | 2,3-Dimethoxytoluene |
| Englischer Name | 2,3-Dimethoxytoluene;3-Methylveratrole;1,2-dimethoxy-3-methylbenzene |
| Molekulare Formel | C9H12O2 |
| Molecular Weight | 152.1904 |
| InChl | InChI=1/C9H12O2/c1-7-5-4-6-8(10-2)9(7)11-3/h4-6H,1-3H3 |
| CAS Registry Number | 4463-33-6 |
| EINECS | 224-726-4 |
| Molecular Structure | ![]() |
| Dichte | 0.99g/cm3 |
| Siedepunkt | 201.4°C at 760 mmHg |
| Brechungsindex | 1.489 |
| Flammpunkt | 67.6°C |
| Dampfdruck | 0.438mmHg at 25°C |
| Risk Codes | R36/38##Irritating to eyes and skin.:; |
| Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |