ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
446831-27-2 2-Piperazin-1-ylbenzoesäure |
|
| Produkt-Name | 2-Piperazin-1-ylbenzoesäure |
| Synonyme | 2-(Piperazin-1-yl)benzoesäure; Benzoesäure, 2-(1-piperazinyl)-; |
| Englischer Name | 2-piperazin-1-ylbenzoic acid;2-(Piperazin-1-yl)benzoic acid;Benzoic acid, 2-(1-piperazinyl)- |
| Molekulare Formel | C11H14N2O2 |
| Molecular Weight | 206.2411 |
| InChl | InChI=1/C11H14N2O2/c14-11(15)9-3-1-2-4-10(9)13-7-5-12-6-8-13/h1-4,12H,5-8H2,(H,14,15) |
| CAS Registry Number | 446831-27-2 |
| Molecular Structure | ![]() |
| Dichte | 1.211g/cm3 |
| Siedepunkt | 399.2°C at 760 mmHg |
| Brechungsindex | 1.58 |
| Flammpunkt | 195.2°C |
| Dampfdruck | 4.33E-07mmHg at 25°C |
| MSDS | |