ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
447-53-0 1,2-Dihydronaphthalene |
|
| Produkt-Name | 1,2-Dihydronaphthalene |
| Englischer Name | 1,2-Dihydronaphthalene;1,2-DIHYDRONAPHTHALENE;naphthalene, 1,2-dihydro- |
| Molekulare Formel | C10H10 |
| Molecular Weight | 130.1864 |
| InChl | InChI=1/C10H10/c1-2-6-10-8-4-3-7-9(10)5-1/h1-3,5-7H,4,8H2 |
| CAS Registry Number | 447-53-0 |
| EINECS | 207-183-8 |
| Molecular Structure | ![]() |
| Dichte | 1.004g/cm3 |
| Schmelzpunkt | -8℃ |
| Siedepunkt | 204.9°C at 760 mmHg |
| Brechungsindex | 1.572 |
| Flammpunkt | 70.4°C |
| Dampfdruck | 0.367mmHg at 25°C |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |