ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4653-08-1 3-(2-thenoyl)propionic acid |
|
Produkt-Name | 3-(2-thenoyl)propionic acid |
Englischer Name | 3-(2-thenoyl)propionic acid;4-Oxo-4-(2-thienyl)butyric acid;4-oxo-4-(thiophen-2-yl)butanoic acid;4-oxo-4-thiophen-2-ylbutanoate |
Molekulare Formel | C8H7O3S |
Molecular Weight | 183.2049 |
InChl | InChI=1/C8H8O3S/c9-6(3-4-8(10)11)7-2-1-5-12-7/h1-2,5H,3-4H2,(H,10,11)/p-1 |
CAS Registry Number | 4653-08-1 |
EINECS | 225-089-5 |
Molecular Structure | ![]() |
Siedepunkt | 400.5°C at 760 mmHg |
Flammpunkt | 196°C |
Dampfdruck | 3.93E-07mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |