ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
467425-85-0 1,3-Bis(1-hydroxy-2,2-dimethoxy-ethyl)harnstoff |
|
| Produkt-Name | 1,3-Bis(1-hydroxy-2,2-dimethoxy-ethyl)harnstoff |
| Synonyme | 1,3-Bis(1-hydroxy-2,2-dimethoxyethyl)harnstoff; Harnstoff, N,N'-bis(1-hydroxy-2,2-dimethoxyethyl)- |
| Englischer Name | 1,3-bis(1-hydroxy-2,2-dimethoxy-ethyl)urea;1,3-Bis(1-hydroxy-2,2-dimethoxyethyl)urea;urea, N,N'-bis(1-hydroxy-2,2-dimethoxyethyl)- |
| Molekulare Formel | C9H20N2O7 |
| Molecular Weight | 268.26 |
| InChl | InChI=1/C9H20N2O7/c1-15-7(16-2)5(12)10-9(14)11-6(13)8(17-3)18-4/h5-8,12-13H,1-4H3,(H2,10,11,14) |
| CAS Registry Number | 467425-85-0 |
| Molecular Structure | ![]() |
| Dichte | 1.254g/cm3 |
| Siedepunkt | 483.8°C at 760 mmHg |
| Brechungsindex | 1.481 |
| Flammpunkt | 246.4°C |
| Dampfdruck | 2.16E-11mmHg at 25°C |
| MSDS | |