ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
501014-44-4 2-Indanylboronic acid diethanolamine cyclic ester |
|
Produkt-Name | 2-Indanylboronic acid diethanolamine cyclic ester |
Englischer Name | 2-Indanylboronic acid diethanolamine cyclic ester;2-(2,3-dihydro-1H-inden-2-yl)-1,3,6,2-dioxazaborocane |
Molekulare Formel | C13H18BNO2 |
Molecular Weight | 231.0985 |
InChl | InChI=1/C13H18BNO2/c1-2-4-12-10-13(9-11(12)3-1)14-16-7-5-15-6-8-17-14/h1-4,13,15H,5-10H2 |
CAS Registry Number | 501014-44-4 |
Molecular Structure | ![]() |
Dichte | 1.101g/cm3 |
Siedepunkt | 350.733°C at 760 mmHg |
Brechungsindex | 1.538 |
Flammpunkt | 165.917°C |
Dampfdruck | 0mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |