ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
502-50-1 4-Ketopimelic acid |
|
| Produkt-Name | 4-Ketopimelic acid |
| Englischer Name | 4-Ketopimelic acid;4-Oxopimelic acid;4-oxoheptanedioic acid;4-oxoheptanedioate |
| Molekulare Formel | C7H8O5 |
| Molecular Weight | 172.1365 |
| InChl | InChI=1/C7H10O5/c8-5(1-3-6(9)10)2-4-7(11)12/h1-4H2,(H,9,10)(H,11,12)/p-2 |
| CAS Registry Number | 502-50-1 |
| EINECS | 207-941-8 |
| Molecular Structure | ![]() |
| Schmelzpunkt | 142-144℃ |
| Siedepunkt | 420.4°C at 760 mmHg |
| Flammpunkt | 222.2°C |
| Dampfdruck | 3.03E-08mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |