ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51-18-3 Triethylenemelamine |
|
| Produkt-Name | Triethylenemelamine |
| Englischer Name | Triethylenemelamine;Tretamine;2,4,6-tri(aziridin-1-yl)-1,3,5-triazine;2,4,6-Tris(1-aziridinyl)-s-triazine;TEM;2,4,6-tris(aziridin-1-yl)-1,3,5-triazine |
| Molekulare Formel | C9H12N6 |
| Molecular Weight | 204.2318 |
| InChl | InChI=1/C9H12N6/c1-2-13(1)7-10-8(14-3-4-14)12-9(11-7)15-5-6-15/h1-6H2 |
| CAS Registry Number | 51-18-3 |
| EINECS | 200-083-5 |
| Molecular Structure | ![]() |
| Dichte | 1.617g/cm3 |
| Schmelzpunkt | 160℃ |
| Siedepunkt | 430.2°C at 760 mmHg |
| Brechungsindex | 1.789 |
| Flammpunkt | 214°C |
| Dampfdruck | 1.32E-07mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R28##Very toxic if swallowed.||R40##Possible risks of irreversible effects.:; |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |