ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
515-00-4 (-)-Myrtenol |
|
| Produkt-Name | (-)-Myrtenol |
| Englischer Name | (-)-Myrtenol;(-)-pin-2-ene-10-ol;(6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl)methanol |
| Molekulare Formel | C10H16O |
| Molecular Weight | 152.2334 |
| InChl | InChI=1/C10H16O/c1-10(2)8-4-3-7(6-11)9(10)5-8/h3,8-9,11H,4-6H2,1-2H3 |
| CAS Registry Number | 515-00-4 |
| EINECS | 208-193-5 |
| Molecular Structure | ![]() |
| Dichte | 0.991g/cm3 |
| Siedepunkt | 224.8°C at 760 mmHg |
| Brechungsindex | 1.504 |
| Flammpunkt | 89.4°C |
| Dampfdruck | 0.0179mmHg at 25°C |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |