ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
519-05-1 2-Carboxy-3,4-dimethoxybenzaldehyde |
|
| Produkt-Name | 2-Carboxy-3,4-dimethoxybenzaldehyde |
| Englischer Name | 2-Carboxy-3,4-dimethoxybenzaldehyde;5,6-Dimethoxyphthalaldehydic acid~6-Formyl-2,3-dimethoxybenzoic acid~Opianic acid;6-formyl-2,3-dimethoxybenzoic acid |
| Molekulare Formel | C10H10O5 |
| Molecular Weight | 210.1834 |
| InChl | InChI=1/C10H10O5/c1-14-7-4-3-6(5-11)8(10(12)13)9(7)15-2/h3-5H,1-2H3,(H,12,13) |
| CAS Registry Number | 519-05-1 |
| EINECS | 208-261-4 |
| Molecular Structure | ![]() |
| Dichte | 1.3g/cm3 |
| Siedepunkt | 386.3°C at 760 mmHg |
| Brechungsindex | 1.573 |
| Flammpunkt | 155.1°C |
| Dampfdruck | 1.17E-06mmHg at 25°C |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |