ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53185-16-3 N~2~-({4-[bis(2-chlorethyl)amino]phenyl}acetyl)-L-asparagin |
|
| Produkt-Name | N~2~-({4-[bis(2-chlorethyl)amino]phenyl}acetyl)-L-asparagin |
| Synonyme | ; |
| Englischer Name | N~2~-({4-[bis(2-chloroethyl)amino]phenyl}acetyl)-L-asparagine; |
| Molekulare Formel | C16H21Cl2N3O4 |
| Molecular Weight | 390.2616 |
| InChl | InChI=1/C16H21Cl2N3O4/c17-5-7-21(8-6-18)12-3-1-11(2-4-12)9-15(23)20-13(16(24)25)10-14(19)22/h1-4,13H,5-10H2,(H2,19,22)(H,20,23)(H,24,25)/t13-/m0/s1 |
| CAS Registry Number | 53185-16-3 |
| Molecular Structure | ![]() |
| Dichte | 1.375g/cm3 |
| Siedepunkt | 726.2°C at 760 mmHg |
| Brechungsindex | 1.594 |
| Flammpunkt | 393°C |
| Dampfdruck | 3.88E-22mmHg at 25°C |
| MSDS | |