ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5326-35-2 5,7-Dibrom-2-phenyl-1H-indol |
|
| Produkt-Name | 5,7-Dibrom-2-phenyl-1H-indol |
| Synonyme | ; |
| Englischer Name | 5,7-dibromo-2-phenyl-1H-indole; |
| Molekulare Formel | C14H9Br2N |
| Molecular Weight | 351.036 |
| InChl | InChI=1/C14H9Br2N/c15-11-6-10-7-13(9-4-2-1-3-5-9)17-14(10)12(16)8-11/h1-8,17H |
| CAS Registry Number | 5326-35-2 |
| Molecular Structure | ![]() |
| Dichte | 1.759g/cm3 |
| Siedepunkt | 484.5°C at 760 mmHg |
| Brechungsindex | 1.716 |
| Flammpunkt | 246.8°C |
| Dampfdruck | 4.52E-09mmHg at 25°C |
| MSDS | |