ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5331-91-9 5-Chloro-2-mercaptobenzothiazole |
|
Produkt-Name | 5-Chloro-2-mercaptobenzothiazole |
Englischer Name | 5-Chloro-2-mercaptobenzothiazole;5-Chloro-2-benzothiazolethiol;5-Chloro-2-mercaptobenzthiazol;2(3H)-Benzothiazolethione,4-chloro-(9CI);2-mercapto-5-chloro benzothiazole;5-chloro-1,3-benzothiazole-2(3H)-thione |
Molekulare Formel | C7H4ClNS2 |
Molecular Weight | 201.6964 |
InChl | InChI=1/C7H4ClNS2/c8-4-1-2-6-5(3-4)9-7(10)11-6/h1-3H,(H,9,10) |
CAS Registry Number | 5331-91-9 |
EINECS | 226-235-0 |
Molecular Structure | ![]() |
Dichte | 1.6g/cm3 |
Schmelzpunkt | 198-200℃ |
Siedepunkt | 333.2°C at 760 mmHg |
Brechungsindex | 1.785 |
Flammpunkt | 155.3°C |
Dampfdruck | 0.000138mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |