ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5337-42-8 trioleyl borate |
|
| Produkt-Name | trioleyl borate |
| Englischer Name | trioleyl borate;Boric acid, trioleyl ester;Trioleyl borate;tri-(9Z)-octadec-9-en-1-yl borate |
| Molekulare Formel | C54H105BO3 |
| Molecular Weight | 813.2207 |
| InChl | InChI=1/C54H105BO3/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-52-56-55(57-53-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2)58-54-51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3/h25-30H,4-24,31-54H2,1-3H3/b28-25-,29-26-,30-27- |
| CAS Registry Number | 5337-42-8 |
| Molecular Structure | ![]() |
| Dichte | 0.863g/cm3 |
| Siedepunkt | 766.7°C at 760 mmHg |
| Brechungsindex | 1.466 |
| Flammpunkt | 310.3°C |
| Dampfdruck | 1.73E-22mmHg at 25°C |
| MSDS | |